22methyl22ethyl
22methyl22ethyl is a chemical compound. Its systematic name indicates a molecule with a central carbon atom bonded to two methyl groups and two ethyl groups. The structure can be represented as CH3-C(CH3)(CH2CH3)-CH2CH3. This compound is a tertiary alkane, meaning the carbon atom at the central position is attached to three other carbon atoms.
The physical properties of 22methyl22ethyl, such as its boiling point and melting point, are influenced by
In terms of chemical reactivity, 22methyl22ethyl behaves like other saturated hydrocarbons. It is relatively unreactive under
22methyl22ethyl is not a commonly encountered compound in industrial applications or natural occurrences. Its synthesis would