trissilanetriol
Trissilanetriol is a chemical compound with the molecular formula C3H10O3Si. It is a triol, meaning it possesses three hydroxyl (-OH) groups, and it also contains a silicon atom. The structure can be visualized as a propane backbone where each carbon atom is bonded to a hydroxyl group and a silicon atom, with the silicon atom also bonded to hydrogen atoms to satisfy its valency. Specifically, it can be represented as CH(OH)SiH3CH(OH)SiH3CH(OH)SiH3. However, this depiction is a simplification, and the exact arrangement and bonding within the molecule are more complex.
Trissilanetriol is typically synthesized through specific chemical reactions involving silanes and suitable precursors. Its properties are
The applications of trissilanetriol are not as widely documented as those of more common organic compounds.