3propylhexane

3-Propylhexane is an organic chemical compound with the molecular formula C9H20. It is an alkane, a saturated hydrocarbon consisting solely of carbon and hydrogen atoms joined by single bonds. Specifically, it is an isomer of nonane, meaning it has the same chemical formula as nonane but a different structural arrangement of atoms. In 3-propylhexane, a propyl group (CH2CH2CH3) is attached to the third carbon atom of a hexane chain (a six-carbon chain).

The structure of 3-propylhexane can be represented as CH3CH2CH(CH2CH2CH3)CH2CH2CH3. It is a branched-chain alkane. Like other alkanes, 3-propylhexane is nonpolar and therefore insoluble in water but soluble in organic solvents. It is expected to be a volatile liquid at room temperature and pressure, with a boiling point characteristic of its molecular weight and branching.

Due to its alkane nature, 3-propylhexane is relatively unreactive under normal conditions. It can undergo combustion in the presence of oxygen to produce carbon dioxide and water. Its primary applications, if any, would likely be as a component in fuels or as a solvent, similar to other isomers of nonane. The synthesis of 3-propylhexane would typically involve standard organic chemistry techniques for alkane synthesis, such as Grignard reactions or Wittig reactions followed by reduction.