3Propylhexane
3-Propylhexane is an organic chemical compound with the molecular formula C9H20. It is an alkane, a saturated hydrocarbon consisting solely of carbon and hydrogen atoms joined by single bonds. Specifically, it is an isomer of nonane, meaning it has the same chemical formula as nonane but a different structural arrangement of atoms. In 3-propylhexane, a propyl group (CH2CH2CH3) is attached to the third carbon atom of a hexane chain (a six-carbon chain).
The structure of 3-propylhexane can be represented as CH3CH2CH(CH2CH2CH3)CH2CH2CH3. It is a branched-chain alkane. Like other
Due to its alkane nature, 3-propylhexane is relatively unreactive under normal conditions. It can undergo combustion